C18H18ClF3N4O2 — CID 30382632
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-[(2-nitrophenyl)methyl]-1,4-diazepane (PubChem CID 30382632) has the molecular formula C18H18ClF3N4O2 and a molecular weight of 414.82 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-[(2-nitrophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-[(2-nitrophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 30382632 |
| Molecular Formula | C18H18ClF3N4O2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-[(2-nitrophenyl)methyl]-1,4-diazepane |
| SMILES | O=[N+]([O-])c1ccccc1CN1CCCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C18H18ClF3N4O2/c19-15-10-14(18(20,21)22)11-23-17(15)25-7-3-6-24(8-9-25)12-13-4-1-2-5-16(13)26(27)28/h1-2,4-5,10-11H,3,6-9,12H2 |
| InChIKey | XXOYBNWOUPKNJO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|