C19H15ClF3N5O4 — CID 27078841
2-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-4-nitroisoindole-1,3-dione (PubChem CID 27078841) has the molecular formula C19H15ClF3N5O4 and a molecular weight of 469.81 g/mol. Its IUPAC name is 2-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 27078841 |
| Molecular Formula | C19H15ClF3N5O4 |
| Molecular Weight | 469.81 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2C(=O)N1CN1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C19H15ClF3N5O4/c20-13-8-11(19(21,22)23)9-24-16(13)26-6-4-25(5-7-26)10-27-17(29)12-2-1-3-14(28(31)32)15(12)18(27)30/h1-3,8-9H,4-7,10H2 |
| InChIKey | JIWHVNFLDCKZKH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|