C18H14ClF3N6O3 — CID 46560132
2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 46560132) has the molecular formula C18H14ClF3N6O3 and a molecular weight of 454.80 g/mol. Its IUPAC name is 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 46560132 |
| Molecular Formula | C18H14ClF3N6O3 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(N2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)nc2ccccn12 |
| InChI | InChI=1S/C18H14ClF3N6O3/c19-12-9-11(18(20,21)22)10-23-15(12)25-5-7-26(8-6-25)16-14(28(30)31)17(29)27-4-2-1-3-13(27)24-16/h1-4,9-10H,5-8H2 |
| InChIKey | RICXSSULKRCSLL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|