C16H15ClF3N5O2 — CID 26448463
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(5-nitro-2-pyridinyl)-1,4-diazepane (PubChem CID 26448463) has the molecular formula C16H15ClF3N5O2 and a molecular weight of 401.78 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(5-nitro-2-pyridinyl)-1,4-diazepane.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(5-nitro-2-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 26448463 |
| Molecular Formula | C16H15ClF3N5O2 |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-(5-nitro-2-pyridinyl)-1,4-diazepane |
| SMILES | O=[N+]([O-])c1ccc(N2CCCN(c3ncc(C(F)(F)F)cc3Cl)CC2)nc1 |
| InChI | InChI=1S/C16H15ClF3N5O2/c17-13-8-11(16(18,19)20)9-22-15(13)24-5-1-4-23(6-7-24)14-3-2-12(10-21-14)25(26)27/h2-3,8-10H,1,4-7H2 |
| InChIKey | QGFCZZUMUBYQQG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|