C16H13ClF3N5 — CID 26452877
2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 26452877) has the molecular formula C16H13ClF3N5 and a molecular weight of 367.76 g/mol. Its IUPAC name is 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 26452877 |
| Molecular Formula | C16H13ClF3N5 |
| Molecular Weight | 367.76 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C16H13ClF3N5/c17-13-8-12(16(18,19)20)10-23-15(13)25-6-4-24(5-7-25)14-11(9-21)2-1-3-22-14/h1-3,8,10H,4-7H2 |
| InChIKey | CFHNPRDCWZNDAU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.76 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |