C16H14Cl2N4 — CID 171335886
2-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 171335886) has the molecular formula C16H14Cl2N4 and a molecular weight of 333.22 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171335886 |
| Molecular Formula | C16H14Cl2N4 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H14Cl2N4/c17-14-4-3-13(10-15(14)18)21-6-8-22(9-7-21)16-12(11-19)2-1-5-20-16/h1-5,10H,6-9H2 |
| InChIKey | RFDTWEAMFKWZMQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |