C17H16ClN3O — CID 172891494
2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 172891494) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 172891494 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H16ClN3O/c18-15-5-3-14(4-6-15)17(22)7-10-21(11-8-17)16-13(12-19)2-1-9-20-16/h1-6,9,22H,7-8,10-11H2 |
| InChIKey | VZPHXTQBRQOEOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |