C11H17Cl3N4 — CID 163329752
2-(4-aminopiperidin-1-yl)pyridine-3-carbonitrile;trihydrochloride (PubChem CID 163329752) has the molecular formula C11H17Cl3N4 and a molecular weight of 311.64 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)pyridine-3-carbonitrile;trihydrochloride.
| Compound Name | 2-(4-aminopiperidin-1-yl)pyridine-3-carbonitrile;trihydrochloride |
|---|---|
| PubChem CID | 163329752 |
| Molecular Formula | C11H17Cl3N4 |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)pyridine-3-carbonitrile;trihydrochloride |
| SMILES | Cl.Cl.Cl.N#Cc1cccnc1N1CCC(N)CC1 |
| InChI | InChI=1S/C11H14N4.3ClH/c12-8-9-2-1-5-14-11(9)15-6-3-10(13)4-7-15;;;/h1-2,5,10H,3-4,6-7,13H2;3*1H |
| InChIKey | NCSZYKQKSJJSOL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |