C14H17N5O2 — CID 73167597
N'-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]oxamide (PubChem CID 73167597) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is N'-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 73167597 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N'-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]oxamide |
| SMILES | N#Cc1cccnc1N1CCC(CNC(=O)C(N)=O)CC1 |
| InChI | InChI=1S/C14H17N5O2/c15-8-11-2-1-5-17-13(11)19-6-3-10(4-7-19)9-18-14(21)12(16)20/h1-2,5,10H,3-4,6-7,9H2,(H2,16,20)(H,18,21) |
| InChIKey | BKWZCDKDEGEIPW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|