C11H3ClF6N4 — CID 3851582
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carbonitrile (PubChem CID 3851582) has the molecular formula C11H3ClF6N4 and a molecular weight of 340.61 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carbonitrile.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 3851582 |
| Molecular Formula | C11H3ClF6N4 |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ncc(C(F)(F)F)cc2Cl)c1C(F)(F)F |
| InChI | InChI=1S/C11H3ClF6N4/c12-7-1-6(10(13,14)15)4-20-9(7)22-8(11(16,17)18)5(2-19)3-21-22/h1,3-4H |
| InChIKey | FIWHJWFKHCXHSN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |