C11H4ClF3N4O — CID 19020335
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-formylpyrazole-4-carbonitrile (PubChem CID 19020335) has the molecular formula C11H4ClF3N4O and a molecular weight of 300.63 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-formylpyrazole-4-carbonitrile.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-formylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 19020335 |
| Molecular Formula | C11H4ClF3N4O |
| Molecular Weight | 300.63 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-formylpyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ncc(C(F)(F)F)cc2Cl)c1C=O |
| InChI | InChI=1S/C11H4ClF3N4O/c12-8-1-7(11(13,14)15)4-17-10(8)19-9(5-20)6(2-16)3-18-19/h1,3-5H |
| InChIKey | UIZVUWFJEOHYGQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|