C11H9ClF3N3O — CID 66439207
[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-methylpyrazol-4-yl]methanol (PubChem CID 66439207) has the molecular formula C11H9ClF3N3O and a molecular weight of 291.66 g/mol. Its IUPAC name is [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-methylpyrazol-4-yl]methanol.
| Compound Name | [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-methylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 66439207 |
| Molecular Formula | C11H9ClF3N3O |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | [1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-5-methylpyrazol-4-yl]methanol |
| SMILES | Cc1c(CO)cnn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H9ClF3N3O/c1-6-7(5-19)3-17-18(6)10-9(12)2-8(4-16-10)11(13,14)15/h2-4,19H,5H2,1H3 |
| InChIKey | VZINSTRBEILAJO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |