C9H5Cl2F3N4 — CID 107447281
3-chloro-2-[5-(chloromethyl)-1,2,4-triazol-1-yl]-5-(trifluoromethyl)pyridine (PubChem CID 107447281) has the molecular formula C9H5Cl2F3N4 and a molecular weight of 297.07 g/mol. Its IUPAC name is 3-chloro-2-[5-(chloromethyl)-1,2,4-triazol-1-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[5-(chloromethyl)-1,2,4-triazol-1-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 107447281 |
| Molecular Formula | C9H5Cl2F3N4 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 3-chloro-2-[5-(chloromethyl)-1,2,4-triazol-1-yl]-5-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cnc(-n2ncnc2CCl)c(Cl)c1 |
| InChI | InChI=1S/C9H5Cl2F3N4/c10-2-7-16-4-17-18(7)8-6(11)1-5(3-15-8)9(12,13)14/h1,3-4H,2H2 |
| InChIKey | OMHWVHYAPBDLRA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|