C16H10ClF3N4O4 — CID 67855010
(2-methoxy-2-oxoethyl) 3-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-cyanopyrazol-5-yl]prop-2-enoate (PubChem CID 67855010) has the molecular formula C16H10ClF3N4O4 and a molecular weight of 414.73 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 3-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-cyanopyrazol-5-yl]prop-2-enoate.
| Compound Name | (2-methoxy-2-oxoethyl) 3-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-cyanopyrazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67855010 |
| Molecular Formula | C16H10ClF3N4O4 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 3-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-cyanopyrazol-5-yl]prop-2-enoate |
| SMILES | COC(=O)COC(=O)C=Cc1c(C#N)cnn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H10ClF3N4O4/c1-27-14(26)8-28-13(25)3-2-12-9(5-21)6-23-24(12)15-11(17)4-10(7-22-15)16(18,19)20/h2-4,6-7H,8H2,1H3 |
| InChIKey | JXZNFRNJBBDCBM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|