C22H21ClF3N3O4 — CID 31710438
[2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 31710438) has the molecular formula C22H21ClF3N3O4 and a molecular weight of 483.87 g/mol. Its IUPAC name is [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 31710438 |
| Molecular Formula | C22H21ClF3N3O4 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)N2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H21ClF3N3O4/c1-32-17-5-2-15(3-6-17)4-7-20(31)33-14-19(30)28-8-10-29(11-9-28)21-18(23)12-16(13-27-21)22(24,25)26/h2-7,12-13H,8-11,14H2,1H3/b7-4+ |
| InChIKey | IRQFWELECCEKEA-QPJJXVBHSA-N |
| XLogP | 3.67 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|