C18H15Cl2F3N4O3 — CID 34255431
[2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 34255431) has the molecular formula C18H15Cl2F3N4O3 and a molecular weight of 463.24 g/mol. Its IUPAC name is [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 34255431 |
| Molecular Formula | C18H15Cl2F3N4O3 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H15Cl2F3N4O3/c19-13-7-12(18(21,22)23)9-25-16(13)27-5-3-26(4-6-27)15(28)10-30-17(29)11-1-2-14(20)24-8-11/h1-2,7-9H,3-6,10H2 |
| InChIKey | JYTOWMDLKUNCIS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|