C17H15ClF3N5O4 — CID 27968751
1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone (PubChem CID 27968751) has the molecular formula C17H15ClF3N5O4 and a molecular weight of 445.79 g/mol. Its IUPAC name is 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone.
| Compound Name | 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
|---|---|
| PubChem CID | 27968751 |
| Molecular Formula | C17H15ClF3N5O4 |
| Molecular Weight | 445.79 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 1-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-[(2-nitro-3-pyridinyl)oxy]ethanone |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C17H15ClF3N5O4/c18-12-8-11(17(19,20)21)9-23-15(12)25-6-4-24(5-7-25)14(27)10-30-13-2-1-3-22-16(13)26(28)29/h1-3,8-9H,4-7,10H2 |
| InChIKey | IPAHAEUSXPJJHR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|