C20H18ClF3N4O5 — CID 33353394
[2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 2-methyl-6-nitrobenzoate (PubChem CID 33353394) has the molecular formula C20H18ClF3N4O5 and a molecular weight of 486.83 g/mol. Its IUPAC name is [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 2-methyl-6-nitrobenzoate.
| Compound Name | [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 33353394 |
| Molecular Formula | C20H18ClF3N4O5 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | [2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-2-oxoethyl] 2-methyl-6-nitrobenzoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)OCC(=O)N1CCN(c2ncc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C20H18ClF3N4O5/c1-12-3-2-4-15(28(31)32)17(12)19(30)33-11-16(29)26-5-7-27(8-6-26)18-14(21)9-13(10-25-18)20(22,23)24/h2-4,9-10H,5-8,11H2,1H3 |
| InChIKey | OOCZSVVGFHZPDZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|