C18H17Cl2F3N4O2 — CID 70523728
ethyl 5-[[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]pentanoate (PubChem CID 70523728) has the molecular formula C18H17Cl2F3N4O2 and a molecular weight of 449.26 g/mol. Its IUPAC name is ethyl 5-[[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]pentanoate.
| Compound Name | ethyl 5-[[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]pentanoate |
|---|---|
| PubChem CID | 70523728 |
| Molecular Formula | C18H17Cl2F3N4O2 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | ethyl 5-[[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]pentanoate |
| SMILES | CCOC(=O)CCCCNc1c(C#N)cnn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C18H17Cl2F3N4O2/c1-2-29-15(28)5-3-4-6-25-17-11(9-24)10-26-27(17)16-13(19)7-12(8-14(16)20)18(21,22)23/h7-8,10,25H,2-6H2,1H3 |
| InChIKey | DPRAEKOEUMRISJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|