About N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide
N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide (PubChem CID 13127610) has the molecular formula C16H11Cl2F3N4O
and a molecular weight of 403.19 g/mol. Its IUPAC name is N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide |
| PubChem CID | 13127610 |
| Molecular Formula | C16H11Cl2F3N4O |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide |
| SMILES | N#Cc1cnn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1NC(=O)C1CCC1 |
| InChI | InChI=1S/C16H11Cl2F3N4O/c17-11-4-10(16(19,20)21)5-12(18)13(11)25-14(9(6-22)7-23-25)24-15(26)8-2-1-3-8/h4-5,7-8H,1-3H2,(H,24,26) |
| InChIKey | WTSMLIPRCHLUSE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide?
The IUPAC name of N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide (CID 13127610) is N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide.
What is the SMILES notation for N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide?
The canonical SMILES for N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide is N#Cc1cnn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1NC(=O)C1CCC1.
What is the InChIKey of N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide?
The InChIKey is WTSMLIPRCHLUSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2F3N4O/c17-11-4-10(16(19,20)21)5-12(18)13(11)25-14(9(6-22)7-23-25)24-15(26)8-2-1-3-8/h4-5,7-8H,1-3H2,(H,24,26).
What are the key properties of N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide?
N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide has a molecular weight of 403.19 g/mol, XLogP of 4.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]cyclobutanecarboxamide is sourced from PubChem (CID 13127610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).