C15H10Cl2F6N4O — CID 10114586
1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(ethoxymethylamino)-3-(trifluoromethyl)pyrazole-4-carbonitrile (PubChem CID 10114586) has the molecular formula C15H10Cl2F6N4O and a molecular weight of 447.17 g/mol. Its IUPAC name is 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(ethoxymethylamino)-3-(trifluoromethyl)pyrazole-4-carbonitrile.
| Compound Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(ethoxymethylamino)-3-(trifluoromethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 10114586 |
| Molecular Formula | C15H10Cl2F6N4O |
| Molecular Weight | 447.17 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-(ethoxymethylamino)-3-(trifluoromethyl)pyrazole-4-carbonitrile |
| SMILES | CCOCNc1c(C#N)c(C(F)(F)F)nn1-c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H10Cl2F6N4O/c1-2-28-6-25-13-8(5-24)12(15(21,22)23)26-27(13)11-9(16)3-7(4-10(11)17)14(18,19)20/h3-4,25H,2,6H2,1H3 |
| InChIKey | RGLXEVALISKZCR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.17 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|