C11H5ClF3N3 — CID 3717416
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbonitrile (PubChem CID 3717416) has the molecular formula C11H5ClF3N3 and a molecular weight of 271.63 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 3717416 |
| Molecular Formula | C11H5ClF3N3 |
| Molecular Weight | 271.63 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H5ClF3N3/c12-9-4-7(11(13,14)15)6-17-10(9)18-3-1-2-8(18)5-16/h1-4,6H |
| InChIKey | JNRVSZLYCPDCOP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |