C14H13ClF3N4S+ — CID 6346199
[[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbothioyl]amino]methylidene-dimethylazanium (PubChem CID 6346199) has the molecular formula C14H13ClF3N4S+ and a molecular weight of 361.80 g/mol. Its IUPAC name is [[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbothioyl]amino]methylidene-dimethylazanium.
| Compound Name | [[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbothioyl]amino]methylidene-dimethylazanium |
|---|---|
| PubChem CID | 6346199 |
| Molecular Formula | C14H13ClF3N4S+ |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | [[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbothioyl]amino]methylidene-dimethylazanium |
| SMILES | C[N+](C)=CNC(=S)c1cccn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H12ClF3N4S/c1-21(2)8-20-13(23)11-4-3-5-22(11)12-10(15)6-9(7-19-12)14(16,17)18/h3-8H,1-2H3/p+1 |
| InChIKey | ZRJIKZNBWMZSSW-UHFFFAOYSA-O |
| XLogP | 3.11 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|