C23H15ClF3N3O — CID 69086376
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(3-phenylphenyl)pyrrole-2-carboxamide (PubChem CID 69086376) has the molecular formula C23H15ClF3N3O and a molecular weight of 441.84 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(3-phenylphenyl)pyrrole-2-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(3-phenylphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 69086376 |
| Molecular Formula | C23H15ClF3N3O |
| Molecular Weight | 441.84 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(3-phenylphenyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)c1cccn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H15ClF3N3O/c24-19-13-17(23(25,26)27)14-28-21(19)30-11-5-10-20(30)22(31)29-18-9-4-8-16(12-18)15-6-2-1-3-7-15/h1-14H,(H,29,31) |
| InChIKey | WUNLCEZCPCWTRU-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.84 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |