C17H9F8N5O — CID 89152151
N',1-bis[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide (PubChem CID 89152151) has the molecular formula C17H9F8N5O and a molecular weight of 451.28 g/mol. Its IUPAC name is N',1-bis[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide.
| Compound Name | N',1-bis[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 89152151 |
| Molecular Formula | C17H9F8N5O |
| Molecular Weight | 451.28 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N',1-bis[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide |
| SMILES | O=C(NNc1ncc(C(F)(F)F)cc1F)c1cccn1-c1ncc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C17H9F8N5O/c18-10-4-8(16(20,21)22)6-26-13(10)28-29-15(31)12-2-1-3-30(12)14-11(19)5-9(7-27-14)17(23,24)25/h1-7H,(H,26,28)(H,29,31) |
| InChIKey | DHFAAHHYZFLWHV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.28 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|