C23H15ClF3N3O2 — CID 69084581
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-phenoxyphenyl)pyrrole-2-carboxamide (PubChem CID 69084581) has the molecular formula C23H15ClF3N3O2 and a molecular weight of 457.84 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-phenoxyphenyl)pyrrole-2-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-phenoxyphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 69084581 |
| Molecular Formula | C23H15ClF3N3O2 |
| Molecular Weight | 457.84 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-(4-phenoxyphenyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)c1cccn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C23H15ClF3N3O2/c24-19-13-15(23(25,26)27)14-28-21(19)30-12-4-7-20(30)22(31)29-16-8-10-18(11-9-16)32-17-5-2-1-3-6-17/h1-14H,(H,29,31) |
| InChIKey | BESSGCZKEUNRPK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.84 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |