C12H7BrClF3N2O — CID 87686993
2-bromo-1-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrol-2-yl]ethanone (PubChem CID 87686993) has the molecular formula C12H7BrClF3N2O and a molecular weight of 367.55 g/mol. Its IUPAC name is 2-bromo-1-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrol-2-yl]ethanone.
| Compound Name | 2-bromo-1-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 87686993 |
| Molecular Formula | C12H7BrClF3N2O |
| Molecular Weight | 367.55 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 2-bromo-1-[1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrol-2-yl]ethanone |
| SMILES | O=C(CBr)c1cccn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H7BrClF3N2O/c13-5-10(20)9-2-1-3-19(9)11-8(14)4-7(6-18-11)12(15,16)17/h1-4,6H,5H2 |
| InChIKey | UYERJAFXXPNJDF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|