C17H9Cl4F3N4O — CID 87686488
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-(2,4,6-trichlorophenyl)pyrrole-2-carbohydrazide (PubChem CID 87686488) has the molecular formula C17H9Cl4F3N4O and a molecular weight of 484.09 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-(2,4,6-trichlorophenyl)pyrrole-2-carbohydrazide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-(2,4,6-trichlorophenyl)pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 87686488 |
| Molecular Formula | C17H9Cl4F3N4O |
| Molecular Weight | 484.09 g/mol |
| Exact Mass | 481.95 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-(2,4,6-trichlorophenyl)pyrrole-2-carbohydrazide |
| SMILES | O=C(NNc1c(Cl)cc(Cl)cc1Cl)c1cccn1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H9Cl4F3N4O/c18-9-5-10(19)14(11(20)6-9)26-27-16(29)13-2-1-3-28(13)15-12(21)4-8(7-25-15)17(22,23)24/h1-7,26H,(H,27,29) |
| InChIKey | KJORXMMGIGGJCD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.09 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|