C18H10Cl2F6N4O — CID 87687911
1-[4-chloro-2-(trifluoromethyl)phenyl]-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide (PubChem CID 87687911) has the molecular formula C18H10Cl2F6N4O and a molecular weight of 483.20 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 87687911 |
| Molecular Formula | C18H10Cl2F6N4O |
| Molecular Weight | 483.20 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyrrole-2-carbohydrazide |
| SMILES | O=C(NNc1ncc(C(F)(F)F)cc1Cl)c1cccn1-c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H10Cl2F6N4O/c19-10-3-4-13(11(7-10)18(24,25)26)30-5-1-2-14(30)16(31)29-28-15-12(20)6-9(8-27-15)17(21,22)23/h1-8H,(H,27,28)(H,29,31) |
| InChIKey | FQMZJMBPYZPGAA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.20 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|