C14H10ClF4N3O2 — CID 166452044
N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluoro-3-methoxybenzohydrazide (PubChem CID 166452044) has the molecular formula C14H10ClF4N3O2 and a molecular weight of 363.70 g/mol. Its IUPAC name is N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluoro-3-methoxybenzohydrazide.
| Compound Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluoro-3-methoxybenzohydrazide |
|---|---|
| PubChem CID | 166452044 |
| Molecular Formula | C14H10ClF4N3O2 |
| Molecular Weight | 363.70 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-4-fluoro-3-methoxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNc2ncc(C(F)(F)F)cc2Cl)ccc1F |
| InChI | InChI=1S/C14H10ClF4N3O2/c1-24-11-4-7(2-3-10(11)16)13(23)22-21-12-9(15)5-8(6-20-12)14(17,18)19/h2-6H,1H3,(H,20,21)(H,22,23) |
| InChIKey | OYBRSQGTSNFORU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|