C14H12ClF3N4O — CID 137476979
3-chloro-N'-[2-(methylamino)-5-(trifluoromethyl)-3-pyridinyl]benzohydrazide (PubChem CID 137476979) has the molecular formula C14H12ClF3N4O and a molecular weight of 344.72 g/mol. Its IUPAC name is 3-chloro-N'-[2-(methylamino)-5-(trifluoromethyl)-3-pyridinyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[2-(methylamino)-5-(trifluoromethyl)-3-pyridinyl]benzohydrazide |
|---|---|
| PubChem CID | 137476979 |
| Molecular Formula | C14H12ClF3N4O |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 3-chloro-N'-[2-(methylamino)-5-(trifluoromethyl)-3-pyridinyl]benzohydrazide |
| SMILES | CNc1ncc(C(F)(F)F)cc1NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12ClF3N4O/c1-19-12-11(6-9(7-20-12)14(16,17)18)21-22-13(23)8-3-2-4-10(15)5-8/h2-7,21H,1H3,(H,19,20)(H,22,23) |
| InChIKey | JFLSCHSUFVBGOL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|