C16H12ClF3N2O2 — CID 27134177
3-chloro-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide (PubChem CID 27134177) has the molecular formula C16H12ClF3N2O2 and a molecular weight of 356.73 g/mol. Its IUPAC name is 3-chloro-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 27134177 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 3-chloro-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-13-3-1-2-11(9-13)15(24)22-21-14(23)8-10-4-6-12(7-5-10)16(18,19)20/h1-7,9H,8H2,(H,21,23)(H,22,24) |
| InChIKey | JPLVKZBFXOQTGJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|