C17H13F3N6O2 — CID 34395340
4-(tetrazol-1-yl)-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide (PubChem CID 34395340) has the molecular formula C17H13F3N6O2 and a molecular weight of 390.33 g/mol. Its IUPAC name is 4-(tetrazol-1-yl)-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide.
| Compound Name | 4-(tetrazol-1-yl)-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 34395340 |
| Molecular Formula | C17H13F3N6O2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-(tetrazol-1-yl)-N'-[2-[4-(trifluoromethyl)phenyl]acetyl]benzohydrazide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)NNC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C17H13F3N6O2/c18-17(19,20)13-5-1-11(2-6-13)9-15(27)22-23-16(28)12-3-7-14(8-4-12)26-10-21-24-25-26/h1-8,10H,9H2,(H,22,27)(H,23,28) |
| InChIKey | MIRALVIQLPGTBL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|