C20H16N6O2 — CID 31540991
N'-(2-naphthalen-2-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide (PubChem CID 31540991) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is N'-(2-naphthalen-2-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide.
| Compound Name | N'-(2-naphthalen-2-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 31540991 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N'-(2-naphthalen-2-ylacetyl)-4-(tetrazol-1-yl)benzohydrazide |
| SMILES | O=C(Cc1ccc2ccccc2c1)NNC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C20H16N6O2/c27-19(12-14-5-6-15-3-1-2-4-17(15)11-14)22-23-20(28)16-7-9-18(10-8-16)26-13-21-24-25-26/h1-11,13H,12H2,(H,22,27)(H,23,28) |
| InChIKey | UZLCODIPYHUGCH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|