C18H13N7O3 — CID 39429005
5-phenyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 39429005) has the molecular formula C18H13N7O3 and a molecular weight of 375.35 g/mol. Its IUPAC name is 5-phenyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-phenyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 39429005 |
| Molecular Formula | C18H13N7O3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 5-phenyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2ccccc2)on1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C18H13N7O3/c26-17(13-6-8-14(9-7-13)25-11-19-23-24-25)20-21-18(27)15-10-16(28-22-15)12-4-2-1-3-5-12/h1-11H,(H,20,26)(H,21,27) |
| InChIKey | ZUVKYTKRENCNAN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|