C19H17N7O2S — CID 31261165
4,5-dimethyl-2-pyrrol-1-yl-N'-[4-(tetrazol-1-yl)benzoyl]thiophene-3-carbohydrazide (PubChem CID 31261165) has the molecular formula C19H17N7O2S and a molecular weight of 407.46 g/mol. Its IUPAC name is 4,5-dimethyl-2-pyrrol-1-yl-N'-[4-(tetrazol-1-yl)benzoyl]thiophene-3-carbohydrazide.
| Compound Name | 4,5-dimethyl-2-pyrrol-1-yl-N'-[4-(tetrazol-1-yl)benzoyl]thiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 31261165 |
| Molecular Formula | C19H17N7O2S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4,5-dimethyl-2-pyrrol-1-yl-N'-[4-(tetrazol-1-yl)benzoyl]thiophene-3-carbohydrazide |
| SMILES | Cc1sc(-n2cccc2)c(C(=O)NNC(=O)c2ccc(-n3cnnn3)cc2)c1C |
| InChI | InChI=1S/C19H17N7O2S/c1-12-13(2)29-19(25-9-3-4-10-25)16(12)18(28)22-21-17(27)14-5-7-15(8-6-14)26-11-20-23-24-26/h3-11H,1-2H3,(H,21,27)(H,22,28) |
| InChIKey | MUILCCZYXGGTHT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|