C21H21N3O4S — CID 8867848
[(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxylate (PubChem CID 8867848) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxylate.
| Compound Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8867848 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(2S)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] 4,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxylate |
| SMILES | Cc1sc(-n2cccc2)c(C(=O)O[C@@H](C)C(=O)NNC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H21N3O4S/c1-13-15(3)29-20(24-11-7-8-12-24)17(13)21(27)28-14(2)18(25)22-23-19(26)16-9-5-4-6-10-16/h4-12,14H,1-3H3,(H,22,25)(H,23,26)/t14-/m0/s1 |
| InChIKey | IIHGLFSAMNADFL-AWEZNQCLSA-N |
| XLogP | 3.16 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|