C15H14N2O5 — CID 8862579
[(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] furan-2-carboxylate (PubChem CID 8862579) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] furan-2-carboxylate.
| Compound Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 8862579 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(2R)-1-(2-benzoylhydrazinyl)-1-oxopropan-2-yl] furan-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccco1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O5/c1-10(22-15(20)12-8-5-9-21-12)13(18)16-17-14(19)11-6-3-2-4-7-11/h2-10H,1H3,(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | ASHRUQGLFNGZEJ-SNVBAGLBSA-N |
| XLogP | 1.29 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|