C19H22N8OS — CID 125431094
4,5-dimethyl-2-(tetrazol-1-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]thiophene-3-carboxamide (PubChem CID 125431094) has the molecular formula C19H22N8OS and a molecular weight of 410.51 g/mol. Its IUPAC name is 4,5-dimethyl-2-(tetrazol-1-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]thiophene-3-carboxamide.
| Compound Name | 4,5-dimethyl-2-(tetrazol-1-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 125431094 |
| Molecular Formula | C19H22N8OS |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4,5-dimethyl-2-(tetrazol-1-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]thiophene-3-carboxamide |
| SMILES | Cc1sc(-n2cnnn2)c(C(=O)NCCCCCc2nnc3ccccn23)c1C |
| InChI | InChI=1S/C19H22N8OS/c1-13-14(2)29-19(27-12-21-24-25-27)17(13)18(28)20-10-6-3-4-8-15-22-23-16-9-5-7-11-26(15)16/h5,7,9,11-12H,3-4,6,8,10H2,1-2H3,(H,20,28) |
| InChIKey | HYEWJRLNKGCREB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|