C19H18N4O2 — CID 91947627
3-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-benzofuran-2-carboxamide (PubChem CID 91947627) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91947627 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3-methyl-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCc2nnc3ccccn23)oc2ccccc12 |
| InChI | InChI=1S/C19H18N4O2/c1-13-14-7-2-3-8-15(14)25-18(13)19(24)20-11-6-10-17-22-21-16-9-4-5-12-23(16)17/h2-5,7-9,12H,6,10-11H2,1H3,(H,20,24) |
| InChIKey | IIXOBDHCBMSDFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|