C20H18N4O3 — CID 91947735
4-methyl-2-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]chromene-3-carboxamide (PubChem CID 91947735) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]chromene-3-carboxamide.
| Compound Name | 4-methyl-2-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 91947735 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-methyl-2-oxo-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]chromene-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCc2nnc3ccccn23)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C20H18N4O3/c1-13-14-7-2-3-8-15(14)27-20(26)18(13)19(25)21-11-6-10-17-23-22-16-9-4-5-12-24(16)17/h2-5,7-9,12H,6,10-11H2,1H3,(H,21,25) |
| InChIKey | XUOCJBCKXPUMGU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|