C15H16N4O3 — CID 91793630
5-methoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]furan-2-carboxamide (PubChem CID 91793630) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 5-methoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-methoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91793630 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 5-methoxy-N-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]furan-2-carboxamide |
| SMILES | COc1ccc(C(=O)NCCCc2nnc3ccccn23)o1 |
| InChI | InChI=1S/C15H16N4O3/c1-21-14-8-7-11(22-14)15(20)16-9-4-6-13-18-17-12-5-2-3-10-19(12)13/h2-3,5,7-8,10H,4,6,9H2,1H3,(H,16,20) |
| InChIKey | VFWHSTIIAKKGSC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|