C16H17N7O2S — CID 60551181
4-methyl-2-propyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 60551181) has the molecular formula C16H17N7O2S and a molecular weight of 371.43 g/mol. Its IUPAC name is 4-methyl-2-propyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-propyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 60551181 |
| Molecular Formula | C16H17N7O2S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-methyl-2-propyl-N'-[4-(tetrazol-1-yl)benzoyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | CCCc1nc(C)c(C(=O)NNC(=O)c2ccc(-n3cnnn3)cc2)s1 |
| InChI | InChI=1S/C16H17N7O2S/c1-3-4-13-18-10(2)14(26-13)16(25)20-19-15(24)11-5-7-12(8-6-11)23-9-17-21-22-23/h5-9H,3-4H2,1-2H3,(H,19,24)(H,20,25) |
| InChIKey | MFAQVBJBMYUAIY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|