C23H17N7O3S — CID 55494664
N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide (PubChem CID 55494664) has the molecular formula C23H17N7O3S and a molecular weight of 471.50 g/mol. Its IUPAC name is N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55494664 |
| Molecular Formula | C23H17N7O3S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]-5-thiophen-2-yl-1,2-oxazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(-c2cccs2)on1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H17N7O3S/c31-22(25-26-23(32)18-13-19(33-28-18)20-7-4-12-34-20)17-10-8-15(9-11-17)14-30-27-21(24-29-30)16-5-2-1-3-6-16/h1-13H,14H2,(H,25,31)(H,26,32) |
| InChIKey | OUWYDPDCGOAWLO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|