C26H25N7O3 — CID 154859144
N-ethyl-N-methyl-3-[[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]carbamoyl]benzamide (PubChem CID 154859144) has the molecular formula C26H25N7O3 and a molecular weight of 483.53 g/mol. Its IUPAC name is N-ethyl-N-methyl-3-[[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]carbamoyl]benzamide.
| Compound Name | N-ethyl-N-methyl-3-[[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]carbamoyl]benzamide |
|---|---|
| PubChem CID | 154859144 |
| Molecular Formula | C26H25N7O3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-ethyl-N-methyl-3-[[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]carbamoyl]benzamide |
| SMILES | CCN(C)C(=O)c1cccc(C(=O)NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)c1 |
| InChI | InChI=1S/C26H25N7O3/c1-3-32(2)26(36)22-11-7-10-21(16-22)25(35)29-28-24(34)20-14-12-18(13-15-20)17-33-30-23(27-31-33)19-8-5-4-6-9-19/h4-16H,3,17H2,1-2H3,(H,28,34)(H,29,35) |
| InChIKey | AKTWGKWZGBKGBE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|