C19H21N7OS — CID 8626706
1-[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]-3-propylthiourea (PubChem CID 8626706) has the molecular formula C19H21N7OS and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]-3-propylthiourea.
| Compound Name | 1-[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]-3-propylthiourea |
|---|---|
| PubChem CID | 8626706 |
| Molecular Formula | C19H21N7OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1-[[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]amino]-3-propylthiourea |
| SMILES | CCCNC(=S)NNC(=O)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H21N7OS/c1-2-12-20-19(28)23-22-18(27)16-10-8-14(9-11-16)13-26-24-17(21-25-26)15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,22,27)(H2,20,23,28) |
| InChIKey | ZZRNNFMZIXOMQG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|