C25H24N6O4 — CID 46652930
3,5-dimethoxy-4-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide (PubChem CID 46652930) has the molecular formula C25H24N6O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is 3,5-dimethoxy-4-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide.
| Compound Name | 3,5-dimethoxy-4-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 46652930 |
| Molecular Formula | C25H24N6O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 3,5-dimethoxy-4-methyl-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)cc(OC)c1C |
| InChI | InChI=1S/C25H24N6O4/c1-16-21(34-2)13-20(14-22(16)35-3)25(33)28-27-24(32)19-11-9-17(10-12-19)15-31-29-23(26-30-31)18-7-5-4-6-8-18/h4-14H,15H2,1-3H3,(H,27,32)(H,28,33) |
| InChIKey | OWHKTZSTHNLBGY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|