C24H20F2N6O4 — CID 46491518
3-(difluoromethoxy)-4-methoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide (PubChem CID 46491518) has the molecular formula C24H20F2N6O4 and a molecular weight of 494.46 g/mol. Its IUPAC name is 3-(difluoromethoxy)-4-methoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide.
| Compound Name | 3-(difluoromethoxy)-4-methoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 46491518 |
| Molecular Formula | C24H20F2N6O4 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-(difluoromethoxy)-4-methoxy-N'-[4-[(5-phenyltetrazol-2-yl)methyl]benzoyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(Cn3nnc(-c4ccccc4)n3)cc2)cc1OC(F)F |
| InChI | InChI=1S/C24H20F2N6O4/c1-35-19-12-11-18(13-20(19)36-24(25)26)23(34)29-28-22(33)17-9-7-15(8-10-17)14-32-30-21(27-31-32)16-5-3-2-4-6-16/h2-13,24H,14H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | VPOJZYDRJRXBNY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|