C23H18F2N6O2 — CID 16553645
N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide (PubChem CID 16553645) has the molecular formula C23H18F2N6O2 and a molecular weight of 448.43 g/mol. Its IUPAC name is N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide.
| Compound Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 16553645 |
| Molecular Formula | C23H18F2N6O2 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-4-[(5-phenyltetrazol-2-yl)methyl]benzamide |
| SMILES | O=C(N/N=C/c1ccc(OC(F)F)cc1)c1ccc(Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H18F2N6O2/c24-23(25)33-20-12-8-16(9-13-20)14-26-28-22(32)19-10-6-17(7-11-19)15-31-29-21(27-30-31)18-4-2-1-3-5-18/h1-14,23H,15H2,(H,28,32)/b26-14+ |
| InChIKey | YCSHIEOKZXDALH-VULFUBBASA-N |
| XLogP | 3.75 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|