C16H14F2N2O2 — CID 6874469
N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-phenylacetamide (PubChem CID 6874469) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 6874469 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[(E)-[4-(difluoromethoxy)phenyl]methylideneamino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H14F2N2O2/c17-16(18)22-14-8-6-13(7-9-14)11-19-20-15(21)10-12-4-2-1-3-5-12/h1-9,11,16H,10H2,(H,20,21)/b19-11+ |
| InChIKey | WAJGYMZUESUUOS-YBFXNURJSA-N |
| XLogP | 2.98 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|